About [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite
[3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite (PubChem CID 145023162) has the molecular formula C9H12FN3O2S
and a molecular weight of 245.28 g/mol. Its IUPAC name is [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite |
| PubChem CID | 145023162 |
| Molecular Formula | C9H12FN3O2S |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite |
| SMILES | NC(=O)CCNC(=O)C1=CC=C(SF)NC1 |
| InChI | InChI=1S/C9H12FN3O2S/c10-16-8-2-1-6(5-13-8)9(15)12-4-3-7(11)14/h1-2,13H,3-5H2,(H2,11,14)(H,12,15) |
| InChIKey | FKJRDSUPETWMDI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite?
The IUPAC name of [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite (CID 145023162) is [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite.
What is the SMILES notation for [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite?
The canonical SMILES for [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite is NC(=O)CCNC(=O)C1=CC=C(SF)NC1.
What is the InChIKey of [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite?
The InChIKey is FKJRDSUPETWMDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN3O2S/c10-16-8-2-1-6(5-13-8)9(15)12-4-3-7(11)14/h1-2,13H,3-5H2,(H2,11,14)(H,12,15).
What are the key properties of [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite?
[3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite has a molecular weight of 245.28 g/mol, XLogP of -0.03, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3-amino-3-oxopropyl)carbamoyl]-1,2-dihydropyridin-6-yl] thiohypofluorite is sourced from PubChem (CID 145023162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).