C11H7ClN2S — CID 11564911
4-[2-(6-chloro-3-pyridinyl)ethynyl]-2-methyl-1,3-thiazole (PubChem CID 11564911) has the molecular formula C11H7ClN2S and a molecular weight of 234.71 g/mol. Its IUPAC name is 4-[2-(6-chloro-3-pyridinyl)ethynyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[2-(6-chloro-3-pyridinyl)ethynyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 11564911 |
| Molecular Formula | C11H7ClN2S |
| Molecular Weight | 234.71 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 4-[2-(6-chloro-3-pyridinyl)ethynyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(C#Cc2ccc(Cl)nc2)cs1 |
| InChI | InChI=1S/C11H7ClN2S/c1-8-14-10(7-15-8)4-2-9-3-5-11(12)13-6-9/h3,5-7H,1H3 |
| InChIKey | PYMPQHSJRUVZKT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.71 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|