C15H15ClN2O — CID 115649159
1-chloro-N-cyclobutyl-N-methylisoquinoline-3-carboxamide (PubChem CID 115649159) has the molecular formula C15H15ClN2O and a molecular weight of 274.75 g/mol. Its IUPAC name is 1-chloro-N-cyclobutyl-N-methylisoquinoline-3-carboxamide.
| Compound Name | 1-chloro-N-cyclobutyl-N-methylisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 115649159 |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-chloro-N-cyclobutyl-N-methylisoquinoline-3-carboxamide |
| SMILES | CN(C(=O)c1cc2ccccc2c(Cl)n1)C1CCC1 |
| InChI | InChI=1S/C15H15ClN2O/c1-18(11-6-4-7-11)15(19)13-9-10-5-2-3-8-12(10)14(16)17-13/h2-3,5,8-9,11H,4,6-7H2,1H3 |
| InChIKey | OIWZYATZWIXGNN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|