C15H17N3O2 — CID 82743415
1-amino-N-methyl-N-(oxolan-3-yl)isoquinoline-3-carboxamide (PubChem CID 82743415) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-amino-N-methyl-N-(oxolan-3-yl)isoquinoline-3-carboxamide.
| Compound Name | 1-amino-N-methyl-N-(oxolan-3-yl)isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 82743415 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-amino-N-methyl-N-(oxolan-3-yl)isoquinoline-3-carboxamide |
| SMILES | CN(C(=O)c1cc2ccccc2c(N)n1)C1CCOC1 |
| InChI | InChI=1S/C15H17N3O2/c1-18(11-6-7-20-9-11)15(19)13-8-10-4-2-3-5-12(10)14(16)17-13/h2-5,8,11H,6-7,9H2,1H3,(H2,16,17) |
| InChIKey | NLQMXQJBXPWEMN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |