C11H14N2O — CID 115651606
5-[(1-cyclopropylethylamino)methyl]furan-2-carbonitrile (PubChem CID 115651606) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-[(1-cyclopropylethylamino)methyl]furan-2-carbonitrile.
| Compound Name | 5-[(1-cyclopropylethylamino)methyl]furan-2-carbonitrile |
|---|---|
| PubChem CID | 115651606 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 5-[(1-cyclopropylethylamino)methyl]furan-2-carbonitrile |
| SMILES | CC(NCc1ccc(C#N)o1)C1CC1 |
| InChI | InChI=1S/C11H14N2O/c1-8(9-2-3-9)13-7-11-5-4-10(6-12)14-11/h4-5,8-9,13H,2-3,7H2,1H3 |
| InChIKey | GHORAKJKJOJEBQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 48.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |