C14H13FN2O — CID 115651492
5-[[1-(4-fluorophenyl)ethylamino]methyl]furan-2-carbonitrile (PubChem CID 115651492) has the molecular formula C14H13FN2O and a molecular weight of 244.27 g/mol. Its IUPAC name is 5-[[1-(4-fluorophenyl)ethylamino]methyl]furan-2-carbonitrile.
| Compound Name | 5-[[1-(4-fluorophenyl)ethylamino]methyl]furan-2-carbonitrile |
|---|---|
| PubChem CID | 115651492 |
| Molecular Formula | C14H13FN2O |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 5-[[1-(4-fluorophenyl)ethylamino]methyl]furan-2-carbonitrile |
| SMILES | CC(NCc1ccc(C#N)o1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H13FN2O/c1-10(11-2-4-12(15)5-3-11)17-9-14-7-6-13(8-16)18-14/h2-7,10,17H,9H2,1H3 |
| InChIKey | QELKMHPQHTXWOC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 48.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |