C13H15FN2O3S — CID 81351138
5-[[[(1R)-1-(4-fluorophenyl)ethyl]amino]methyl]furan-2-sulfonamide (PubChem CID 81351138) has the molecular formula C13H15FN2O3S and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-[[[(1R)-1-(4-fluorophenyl)ethyl]amino]methyl]furan-2-sulfonamide.
| Compound Name | 5-[[[(1R)-1-(4-fluorophenyl)ethyl]amino]methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 81351138 |
| Molecular Formula | C13H15FN2O3S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-[[[(1R)-1-(4-fluorophenyl)ethyl]amino]methyl]furan-2-sulfonamide |
| SMILES | C[C@@H](NCc1ccc(S(N)(=O)=O)o1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN2O3S/c1-9(10-2-4-11(14)5-3-10)16-8-12-6-7-13(19-12)20(15,17)18/h2-7,9,16H,8H2,1H3,(H2,15,17,18)/t9-/m1/s1 |
| InChIKey | XFNUHLUCGGRFMO-SECBINFHSA-N |
| XLogP | 1.92 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |