C10H18N2OS2 — CID 115654243
N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-methylsulfanylpropan-1-amine (PubChem CID 115654243) has the molecular formula C10H18N2OS2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-methylsulfanylpropan-1-amine.
| Compound Name | N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 115654243 |
| Molecular Formula | C10H18N2OS2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-methylsulfanylpropan-1-amine |
| SMILES | COCc1nc(CNCCCSC)cs1 |
| InChI | InChI=1S/C10H18N2OS2/c1-13-7-10-12-9(8-15-10)6-11-4-3-5-14-2/h8,11H,3-7H2,1-2H3 |
| InChIKey | GYJBPTRJOPUDRX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|