C12H18N2 — CID 115654846
N-[(1-methylpyrrol-2-yl)methyl]hex-5-yn-3-amine (PubChem CID 115654846) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N-[(1-methylpyrrol-2-yl)methyl]hex-5-yn-3-amine.
| Compound Name | N-[(1-methylpyrrol-2-yl)methyl]hex-5-yn-3-amine |
|---|---|
| PubChem CID | 115654846 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N-[(1-methylpyrrol-2-yl)methyl]hex-5-yn-3-amine |
| SMILES | C#CCC(CC)NCc1cccn1C |
| InChI | InChI=1S/C12H18N2/c1-4-7-11(5-2)13-10-12-8-6-9-14(12)3/h1,6,8-9,11,13H,5,7,10H2,2-3H3 |
| InChIKey | PSOQXOQNLDSHBO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|