C11H20N4 — CID 115656536
N-[4-(1,2,4-triazol-4-yl)butyl]cyclopentanamine (PubChem CID 115656536) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N-[4-(1,2,4-triazol-4-yl)butyl]cyclopentanamine.
| Compound Name | N-[4-(1,2,4-triazol-4-yl)butyl]cyclopentanamine |
|---|---|
| PubChem CID | 115656536 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N-[4-(1,2,4-triazol-4-yl)butyl]cyclopentanamine |
| SMILES | c1nncn1CCCCNC1CCCC1 |
| InChI | InChI=1S/C11H20N4/c1-2-6-11(5-1)12-7-3-4-8-15-9-13-14-10-15/h9-12H,1-8H2 |
| InChIKey | IWOPFHFWGUMFHC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|