About 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one
3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one (PubChem CID 115657393) has the molecular formula C10H11N5O
and a molecular weight of 217.23 g/mol. Its IUPAC name is 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one.
Molecular Properties
| Compound Name | 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one |
| PubChem CID | 115657393 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one |
| SMILES | O=c1[nH]ccnc1N1CCn2ccnc2C1 |
| InChI | InChI=1S/C10H11N5O/c16-10-9(12-1-2-13-10)15-6-5-14-4-3-11-8(14)7-15/h1-4H,5-7H2,(H,13,16) |
| InChIKey | MKASORDOZXLJRG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one?
The IUPAC name of 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one (CID 115657393) is 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one.
What is the SMILES notation for 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one?
The canonical SMILES for 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one is O=c1[nH]ccnc1N1CCn2ccnc2C1.
What is the InChIKey of 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one?
The InChIKey is MKASORDOZXLJRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O/c16-10-9(12-1-2-13-10)15-6-5-14-4-3-11-8(14)7-15/h1-4H,5-7H2,(H,13,16).
What are the key properties of 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one?
3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one has a molecular weight of 217.23 g/mol, XLogP of -0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1H-pyrazin-2-one is sourced from PubChem (CID 115657393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).