C8H12N2O2S — CID 115659260
N-ethyl-N-methyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 115659260) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide.
| Compound Name | N-ethyl-N-methyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 115659260 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-ethyl-N-methyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | CCN(C)C(=O)Cn1ccsc1=O |
| InChI | InChI=1S/C8H12N2O2S/c1-3-9(2)7(11)6-10-4-5-13-8(10)12/h4-5H,3,6H2,1-2H3 |
| InChIKey | GTUZPZJJNRFRBS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |