About 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one
3-(oxan-4-ylmethyl)-1,3-thiazol-2-one (PubChem CID 115659277) has the molecular formula C9H13NO2S
and a molecular weight of 199.27 g/mol. Its IUPAC name is 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one |
| PubChem CID | 115659277 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one |
| SMILES | O=c1sccn1CC1CCOCC1 |
| InChI | InChI=1S/C9H13NO2S/c11-9-10(3-6-13-9)7-8-1-4-12-5-2-8/h3,6,8H,1-2,4-5,7H2 |
| InChIKey | IGJYQVDNSYUMRI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one?
The IUPAC name of 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one (CID 115659277) is 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one.
What is the SMILES notation for 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one?
The canonical SMILES for 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one is O=c1sccn1CC1CCOCC1.
What is the InChIKey of 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one?
The InChIKey is IGJYQVDNSYUMRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c11-9-10(3-6-13-9)7-8-1-4-12-5-2-8/h3,6,8H,1-2,4-5,7H2.
What are the key properties of 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one?
3-(oxan-4-ylmethyl)-1,3-thiazol-2-one has a molecular weight of 199.27 g/mol, XLogP of 1.34, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxan-4-ylmethyl)-1,3-thiazol-2-one is sourced from PubChem (CID 115659277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).