C9H12N2O2S — CID 115659282
N-(cyclopropylmethyl)-2-(2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 115659282) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(2-oxo-1,3-thiazol-3-yl)acetamide.
| Compound Name | N-(cyclopropylmethyl)-2-(2-oxo-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 115659282 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | O=C(Cn1ccsc1=O)NCC1CC1 |
| InChI | InChI=1S/C9H12N2O2S/c12-8(10-5-7-1-2-7)6-11-3-4-14-9(11)13/h3-4,7H,1-2,5-6H2,(H,10,12) |
| InChIKey | DPVVUMAISHRMMI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |