C14H14N2O2 — CID 115661987
2-(4-cyanophenoxy)-N-pent-4-yn-2-ylacetamide (PubChem CID 115661987) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-pent-4-yn-2-ylacetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-pent-4-yn-2-ylacetamide |
|---|---|
| PubChem CID | 115661987 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-pent-4-yn-2-ylacetamide |
| SMILES | C#CCC(C)NC(=O)COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H14N2O2/c1-3-4-11(2)16-14(17)10-18-13-7-5-12(9-15)6-8-13/h1,5-8,11H,4,10H2,2H3,(H,16,17) |
| InChIKey | RRKUQQZTJRDSNG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|