C13H19BrN2 — CID 115666639
5-bromo-2-[(2,5-dimethylpiperidin-1-yl)methyl]pyridine (PubChem CID 115666639) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is 5-bromo-2-[(2,5-dimethylpiperidin-1-yl)methyl]pyridine.
| Compound Name | 5-bromo-2-[(2,5-dimethylpiperidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 115666639 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 5-bromo-2-[(2,5-dimethylpiperidin-1-yl)methyl]pyridine |
| SMILES | CC1CCC(C)N(Cc2ccc(Br)cn2)C1 |
| InChI | InChI=1S/C13H19BrN2/c1-10-3-4-11(2)16(8-10)9-13-6-5-12(14)7-15-13/h5-7,10-11H,3-4,8-9H2,1-2H3 |
| InChIKey | YGSIOOJSLBZSTI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |