C12H17NO3S — CID 115670411
methyl 4-(2-thiophen-2-ylethyl)morpholine-3-carboxylate (PubChem CID 115670411) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is methyl 4-(2-thiophen-2-ylethyl)morpholine-3-carboxylate.
| Compound Name | methyl 4-(2-thiophen-2-ylethyl)morpholine-3-carboxylate |
|---|---|
| PubChem CID | 115670411 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | methyl 4-(2-thiophen-2-ylethyl)morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1CCc1cccs1 |
| InChI | InChI=1S/C12H17NO3S/c1-15-12(14)11-9-16-7-6-13(11)5-4-10-3-2-8-17-10/h2-3,8,11H,4-7,9H2,1H3 |
| InChIKey | LDVVRQINKLOXOZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |