C13H19NO2S — CID 55236129
ethyl 1-(2-thiophen-2-ylethyl)pyrrolidine-2-carboxylate (PubChem CID 55236129) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is ethyl 1-(2-thiophen-2-ylethyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-(2-thiophen-2-ylethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55236129 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | ethyl 1-(2-thiophen-2-ylethyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1CCc1cccs1 |
| InChI | InChI=1S/C13H19NO2S/c1-2-16-13(15)12-6-3-8-14(12)9-7-11-5-4-10-17-11/h4-5,10,12H,2-3,6-9H2,1H3 |
| InChIKey | UTPNLPLHDODFPS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |