C12H15NO2S — CID 115670893
N-hex-5-yn-3-yl-4-methoxythiophene-2-carboxamide (PubChem CID 115670893) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is N-hex-5-yn-3-yl-4-methoxythiophene-2-carboxamide.
| Compound Name | N-hex-5-yn-3-yl-4-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 115670893 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | N-hex-5-yn-3-yl-4-methoxythiophene-2-carboxamide |
| SMILES | C#CCC(CC)NC(=O)c1cc(OC)cs1 |
| InChI | InChI=1S/C12H15NO2S/c1-4-6-9(5-2)13-12(14)11-7-10(15-3)8-16-11/h1,7-9H,5-6H2,2-3H3,(H,13,14) |
| InChIKey | JFCBEUFTMBAPJP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|