C11H16INO2S — CID 107860185
N-(1-iodo-3-methylbutan-2-yl)-4-methoxythiophene-2-carboxamide (PubChem CID 107860185) has the molecular formula C11H16INO2S and a molecular weight of 353.23 g/mol. Its IUPAC name is N-(1-iodo-3-methylbutan-2-yl)-4-methoxythiophene-2-carboxamide.
| Compound Name | N-(1-iodo-3-methylbutan-2-yl)-4-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 107860185 |
| Molecular Formula | C11H16INO2S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | N-(1-iodo-3-methylbutan-2-yl)-4-methoxythiophene-2-carboxamide |
| SMILES | COc1csc(C(=O)NC(CI)C(C)C)c1 |
| InChI | InChI=1S/C11H16INO2S/c1-7(2)9(5-12)13-11(14)10-4-8(15-3)6-16-10/h4,6-7,9H,5H2,1-3H3,(H,13,14) |
| InChIKey | ZJZVINHJMGUACY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|