C9H17N3S — CID 115671266
N-[(2-methylpyrazol-3-yl)methyl]-1-methylsulfanylpropan-2-amine (PubChem CID 115671266) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is N-[(2-methylpyrazol-3-yl)methyl]-1-methylsulfanylpropan-2-amine.
| Compound Name | N-[(2-methylpyrazol-3-yl)methyl]-1-methylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 115671266 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | N-[(2-methylpyrazol-3-yl)methyl]-1-methylsulfanylpropan-2-amine |
| SMILES | CSCC(C)NCc1ccnn1C |
| InChI | InChI=1S/C9H17N3S/c1-8(7-13-3)10-6-9-4-5-11-12(9)2/h4-5,8,10H,6-7H2,1-3H3 |
| InChIKey | DADLQXJFGHVBRO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |