About N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide
N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide (PubChem CID 115672861) has the molecular formula C17H26N2O
and a molecular weight of 274.41 g/mol. Its IUPAC name is N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide |
| PubChem CID | 115672861 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide |
| SMILES | Cc1cc(C)c(C(C)NC(C)C(=O)NC2CC2)c(C)c1 |
| InChI | InChI=1S/C17H26N2O/c1-10-8-11(2)16(12(3)9-10)13(4)18-14(5)17(20)19-15-6-7-15/h8-9,13-15,18H,6-7H2,1-5H3,(H,19,20) |
| InChIKey | HDFKWPJQMKVDDS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide?
The IUPAC name of N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide (CID 115672861) is N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide.
What is the SMILES notation for N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide?
The canonical SMILES for N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide is Cc1cc(C)c(C(C)NC(C)C(=O)NC2CC2)c(C)c1.
What is the InChIKey of N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide?
The InChIKey is HDFKWPJQMKVDDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O/c1-10-8-11(2)16(12(3)9-10)13(4)18-14(5)17(20)19-15-6-7-15/h8-9,13-15,18H,6-7H2,1-5H3,(H,19,20).
What are the key properties of N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide?
N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide has a molecular weight of 274.41 g/mol, XLogP of 2.93, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-[1-(2,4,6-trimethylphenyl)ethylamino]propanamide is sourced from PubChem (CID 115672861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).