C11H14BrN3 — CID 115673209
3-[(5-bromo-3-pyridinyl)methyl-ethylamino]propanenitrile (PubChem CID 115673209) has the molecular formula C11H14BrN3 and a molecular weight of 268.16 g/mol. Its IUPAC name is 3-[(5-bromo-3-pyridinyl)methyl-ethylamino]propanenitrile.
| Compound Name | 3-[(5-bromo-3-pyridinyl)methyl-ethylamino]propanenitrile |
|---|---|
| PubChem CID | 115673209 |
| Molecular Formula | C11H14BrN3 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 3-[(5-bromo-3-pyridinyl)methyl-ethylamino]propanenitrile |
| SMILES | CCN(CCC#N)Cc1cncc(Br)c1 |
| InChI | InChI=1S/C11H14BrN3/c1-2-15(5-3-4-13)9-10-6-11(12)8-14-7-10/h6-8H,2-3,5,9H2,1H3 |
| InChIKey | PKDPXLJKYRFAII-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |