C11H14N2OS — CID 115675851
5-[[(1-hydroxycyclobutyl)methylamino]methyl]thiophene-2-carbonitrile (PubChem CID 115675851) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 5-[[(1-hydroxycyclobutyl)methylamino]methyl]thiophene-2-carbonitrile.
| Compound Name | 5-[[(1-hydroxycyclobutyl)methylamino]methyl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 115675851 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 5-[[(1-hydroxycyclobutyl)methylamino]methyl]thiophene-2-carbonitrile |
| SMILES | N#Cc1ccc(CNCC2(O)CCC2)s1 |
| InChI | InChI=1S/C11H14N2OS/c12-6-9-2-3-10(15-9)7-13-8-11(14)4-1-5-11/h2-3,13-14H,1,4-5,7-8H2 |
| InChIKey | SOFDMKSWCRJYCV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |