C8H13NOS — CID 115680000
4-ethyl-2-(1-methoxyethyl)-1,3-thiazole (PubChem CID 115680000) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is 4-ethyl-2-(1-methoxyethyl)-1,3-thiazole.
| Compound Name | 4-ethyl-2-(1-methoxyethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 115680000 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 4-ethyl-2-(1-methoxyethyl)-1,3-thiazole |
| SMILES | CCc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C8H13NOS/c1-4-7-5-11-8(9-7)6(2)10-3/h5-6H,4H2,1-3H3 |
| InChIKey | OJVFNZHHVVPWIB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |