C10H10BrF2NO — CID 115680068
4-[(2-bromoprop-2-enylamino)methyl]-2,6-difluorophenol (PubChem CID 115680068) has the molecular formula C10H10BrF2NO and a molecular weight of 278.10 g/mol. Its IUPAC name is 4-[(2-bromoprop-2-enylamino)methyl]-2,6-difluorophenol.
| Compound Name | 4-[(2-bromoprop-2-enylamino)methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 115680068 |
| Molecular Formula | C10H10BrF2NO |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 4-[(2-bromoprop-2-enylamino)methyl]-2,6-difluorophenol |
| SMILES | C=C(Br)CNCc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C10H10BrF2NO/c1-6(11)4-14-5-7-2-8(12)10(15)9(13)3-7/h2-3,14-15H,1,4-5H2 |
| InChIKey | GRCZDMFQBWASEB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |