C11H17ClN2O2S — CID 115680468
N-[(1-methylcyclobutyl)methyl]-1-(5-nitrothiophen-3-yl)methanamine;hydrochloride (PubChem CID 115680468) has the molecular formula C11H17ClN2O2S and a molecular weight of 276.79 g/mol. Its IUPAC name is N-[(1-methylcyclobutyl)methyl]-1-(5-nitrothiophen-3-yl)methanamine;hydrochloride.
| Compound Name | N-[(1-methylcyclobutyl)methyl]-1-(5-nitrothiophen-3-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 115680468 |
| Molecular Formula | C11H17ClN2O2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-[(1-methylcyclobutyl)methyl]-1-(5-nitrothiophen-3-yl)methanamine;hydrochloride |
| SMILES | CC1(CNCc2csc([N+](=O)[O-])c2)CCC1.Cl |
| InChI | InChI=1S/C11H16N2O2S.ClH/c1-11(3-2-4-11)8-12-6-9-5-10(13(14)15)16-7-9;/h5,7,12H,2-4,6,8H2,1H3;1H |
| InChIKey | RYRYLJLALQASTP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|