C13H16N4O3S — CID 115682000
N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methoxy-3-nitropyridin-2-amine (PubChem CID 115682000) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methoxy-3-nitropyridin-2-amine.
| Compound Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methoxy-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 115682000 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methoxy-3-nitropyridin-2-amine |
| SMILES | CCc1cnc(C(C)Nc2nc(OC)ccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H16N4O3S/c1-4-9-7-14-13(21-9)8(2)15-12-10(17(18)19)5-6-11(16-12)20-3/h5-8H,4H2,1-3H3,(H,15,16) |
| InChIKey | HQRXRFNLCPAEJS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|