C12H23N5O — CID 115682116
2-methyl-N-[(3-methyltriazol-4-yl)methyl]-2-morpholin-4-ylpropan-1-amine (PubChem CID 115682116) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-methyl-N-[(3-methyltriazol-4-yl)methyl]-2-morpholin-4-ylpropan-1-amine.
| Compound Name | 2-methyl-N-[(3-methyltriazol-4-yl)methyl]-2-morpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 115682116 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 2-methyl-N-[(3-methyltriazol-4-yl)methyl]-2-morpholin-4-ylpropan-1-amine |
| SMILES | Cn1nncc1CNCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C12H23N5O/c1-12(2,17-4-6-18-7-5-17)10-13-8-11-9-14-15-16(11)3/h9,13H,4-8,10H2,1-3H3 |
| InChIKey | PIMRTQTVTRYQPA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |