C13H24N4O — CID 43663587
2-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-2-morpholin-4-ylpropan-1-amine (PubChem CID 43663587) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-2-morpholin-4-ylpropan-1-amine.
| Compound Name | 2-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-2-morpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 43663587 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 2-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-2-morpholin-4-ylpropan-1-amine |
| SMILES | Cc1[nH]ncc1CNCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C13H24N4O/c1-11-12(9-15-16-11)8-14-10-13(2,3)17-4-6-18-7-5-17/h9,14H,4-8,10H2,1-3H3,(H,15,16) |
| InChIKey | VIFZQFISSMZVJO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |