C15H22Cl2N2O2 — CID 29030381
2,4-dichloro-6-[[(2-methyl-2-morpholin-4-ylpropyl)amino]methyl]phenol (PubChem CID 29030381) has the molecular formula C15H22Cl2N2O2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(2-methyl-2-morpholin-4-ylpropyl)amino]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(2-methyl-2-morpholin-4-ylpropyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 29030381 |
| Molecular Formula | C15H22Cl2N2O2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2,4-dichloro-6-[[(2-methyl-2-morpholin-4-ylpropyl)amino]methyl]phenol |
| SMILES | CC(C)(CNCc1cc(Cl)cc(Cl)c1O)N1CCOCC1 |
| InChI | InChI=1S/C15H22Cl2N2O2/c1-15(2,19-3-5-21-6-4-19)10-18-9-11-7-12(16)8-13(17)14(11)20/h7-8,18,20H,3-6,9-10H2,1-2H3 |
| InChIKey | FCKXFLNPOXJCPQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|