About 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide
3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide (PubChem CID 115686050) has the molecular formula C16H21N3OS
and a molecular weight of 303.43 g/mol. Its IUPAC name is 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide.
Molecular Properties
| Compound Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide |
| PubChem CID | 115686050 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide |
| SMILES | Cc1c(NCc2csc(C(C)(C)C)n2)cccc1C(N)=O |
| InChI | InChI=1S/C16H21N3OS/c1-10-12(14(17)20)6-5-7-13(10)18-8-11-9-21-15(19-11)16(2,3)4/h5-7,9,18H,8H2,1-4H3,(H2,17,20) |
| InChIKey | XYQPQBTZRKNVNV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide?
The IUPAC name of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide (CID 115686050) is 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide.
What is the SMILES notation for 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide?
The canonical SMILES for 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide is Cc1c(NCc2csc(C(C)(C)C)n2)cccc1C(N)=O.
What is the InChIKey of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide?
The InChIKey is XYQPQBTZRKNVNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3OS/c1-10-12(14(17)20)6-5-7-13(10)18-8-11-9-21-15(19-11)16(2,3)4/h5-7,9,18H,8H2,1-4H3,(H2,17,20).
What are the key properties of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide?
3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide has a molecular weight of 303.43 g/mol, XLogP of 3.46, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylamino]-2-methylbenzamide is sourced from PubChem (CID 115686050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).