C10H16N2OS — CID 115686537
1-ethyl-3-[(3-ethylthiophen-2-yl)methyl]urea (PubChem CID 115686537) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 1-ethyl-3-[(3-ethylthiophen-2-yl)methyl]urea.
| Compound Name | 1-ethyl-3-[(3-ethylthiophen-2-yl)methyl]urea |
|---|---|
| PubChem CID | 115686537 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-ethyl-3-[(3-ethylthiophen-2-yl)methyl]urea |
| SMILES | CCNC(=O)NCc1sccc1CC |
| InChI | InChI=1S/C10H16N2OS/c1-3-8-5-6-14-9(8)7-12-10(13)11-4-2/h5-6H,3-4,7H2,1-2H3,(H2,11,12,13) |
| InChIKey | SYQUCXVVFSBMFF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |