C11H17NO2S — CID 116656798
propan-2-yl N-[(3-ethylthiophen-2-yl)methyl]carbamate (PubChem CID 116656798) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is propan-2-yl N-[(3-ethylthiophen-2-yl)methyl]carbamate.
| Compound Name | propan-2-yl N-[(3-ethylthiophen-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 116656798 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | propan-2-yl N-[(3-ethylthiophen-2-yl)methyl]carbamate |
| SMILES | CCc1ccsc1CNC(=O)OC(C)C |
| InChI | InChI=1S/C11H17NO2S/c1-4-9-5-6-15-10(9)7-12-11(13)14-8(2)3/h5-6,8H,4,7H2,1-3H3,(H,12,13) |
| InChIKey | GIKGFPGKDJXZGT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |