C12H20N2OS2 — CID 113254036
1-[(3-ethylthiophen-2-yl)methyl]-3-(1-methoxypropan-2-yl)thiourea (PubChem CID 113254036) has the molecular formula C12H20N2OS2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-[(3-ethylthiophen-2-yl)methyl]-3-(1-methoxypropan-2-yl)thiourea.
| Compound Name | 1-[(3-ethylthiophen-2-yl)methyl]-3-(1-methoxypropan-2-yl)thiourea |
|---|---|
| PubChem CID | 113254036 |
| Molecular Formula | C12H20N2OS2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-[(3-ethylthiophen-2-yl)methyl]-3-(1-methoxypropan-2-yl)thiourea |
| SMILES | CCc1ccsc1CNC(=S)NC(C)COC |
| InChI | InChI=1S/C12H20N2OS2/c1-4-10-5-6-17-11(10)7-13-12(16)14-9(2)8-15-3/h5-6,9H,4,7-8H2,1-3H3,(H2,13,14,16) |
| InChIKey | ZGXYQHXSSOXBPS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|