C11H18N2OS2 — CID 115579102
1-(1-methoxypropan-2-yl)-3-[(3-methylthiophen-2-yl)methyl]thiourea (PubChem CID 115579102) has the molecular formula C11H18N2OS2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-3-[(3-methylthiophen-2-yl)methyl]thiourea.
| Compound Name | 1-(1-methoxypropan-2-yl)-3-[(3-methylthiophen-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 115579102 |
| Molecular Formula | C11H18N2OS2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-3-[(3-methylthiophen-2-yl)methyl]thiourea |
| SMILES | COCC(C)NC(=S)NCc1sccc1C |
| InChI | InChI=1S/C11H18N2OS2/c1-8-4-5-16-10(8)6-12-11(15)13-9(2)7-14-3/h4-5,9H,6-7H2,1-3H3,(H2,12,13,15) |
| InChIKey | WXYCSFYBIQNQIP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|