C13H24N2OS — CID 62553697
N'-(1-methoxypropan-2-yl)-N'-methyl-N-[(3-methylthiophen-2-yl)methyl]ethane-1,2-diamine (PubChem CID 62553697) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is N'-(1-methoxypropan-2-yl)-N'-methyl-N-[(3-methylthiophen-2-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-(1-methoxypropan-2-yl)-N'-methyl-N-[(3-methylthiophen-2-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62553697 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N'-(1-methoxypropan-2-yl)-N'-methyl-N-[(3-methylthiophen-2-yl)methyl]ethane-1,2-diamine |
| SMILES | COCC(C)N(C)CCNCc1sccc1C |
| InChI | InChI=1S/C13H24N2OS/c1-11-5-8-17-13(11)9-14-6-7-15(3)12(2)10-16-4/h5,8,12,14H,6-7,9-10H2,1-4H3 |
| InChIKey | LZHWWUIIVKRDOW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|