C14H26N2S — CID 115687367
1-cyclopropyl-3-[[1-(2-methylpropyl)cyclopentyl]methyl]thiourea (PubChem CID 115687367) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is 1-cyclopropyl-3-[[1-(2-methylpropyl)cyclopentyl]methyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[[1-(2-methylpropyl)cyclopentyl]methyl]thiourea |
|---|---|
| PubChem CID | 115687367 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 1-cyclopropyl-3-[[1-(2-methylpropyl)cyclopentyl]methyl]thiourea |
| SMILES | CC(C)CC1(CNC(=S)NC2CC2)CCCC1 |
| InChI | InChI=1S/C14H26N2S/c1-11(2)9-14(7-3-4-8-14)10-15-13(17)16-12-5-6-12/h11-12H,3-10H2,1-2H3,(H2,15,16,17) |
| InChIKey | NLSHKUHXYGBJBM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|