C12H19BrN2O3S2 — CID 115690361
5-bromo-N-[(4-ethylmorpholin-2-yl)methyl]-2-methylthiophene-3-sulfonamide (PubChem CID 115690361) has the molecular formula C12H19BrN2O3S2 and a molecular weight of 383.33 g/mol. Its IUPAC name is 5-bromo-N-[(4-ethylmorpholin-2-yl)methyl]-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-bromo-N-[(4-ethylmorpholin-2-yl)methyl]-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 115690361 |
| Molecular Formula | C12H19BrN2O3S2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 5-bromo-N-[(4-ethylmorpholin-2-yl)methyl]-2-methylthiophene-3-sulfonamide |
| SMILES | CCN1CCOC(CNS(=O)(=O)c2cc(Br)sc2C)C1 |
| InChI | InChI=1S/C12H19BrN2O3S2/c1-3-15-4-5-18-10(8-15)7-14-20(16,17)11-6-12(13)19-9(11)2/h6,10,14H,3-5,7-8H2,1-2H3 |
| InChIKey | JYXKFRNSIIQYMI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |