C13H18N2S — CID 115694154
N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]hex-5-yn-1-amine (PubChem CID 115694154) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]hex-5-yn-1-amine.
| Compound Name | N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]hex-5-yn-1-amine |
|---|---|
| PubChem CID | 115694154 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]hex-5-yn-1-amine |
| SMILES | C#CCCCCNCc1csc(C2CC2)n1 |
| InChI | InChI=1S/C13H18N2S/c1-2-3-4-5-8-14-9-12-10-16-13(15-12)11-6-7-11/h1,10-11,14H,3-9H2 |
| InChIKey | MMFAQALERPKIMG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|