C14H16F2N2S — CID 115694591
N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3,4-difluoroaniline (PubChem CID 115694591) has the molecular formula C14H16F2N2S and a molecular weight of 282.36 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3,4-difluoroaniline.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3,4-difluoroaniline |
|---|---|
| PubChem CID | 115694591 |
| Molecular Formula | C14H16F2N2S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3,4-difluoroaniline |
| SMILES | CC(C)(C)c1nc(CNc2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C14H16F2N2S/c1-14(2,3)13-18-10(8-19-13)7-17-9-4-5-11(15)12(16)6-9/h4-6,8,17H,7H2,1-3H3 |
| InChIKey | IWMKTJWBLLYUNZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |