C12H12ClFN2S — CID 115280365
3-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-4-fluoroaniline (PubChem CID 115280365) has the molecular formula C12H12ClFN2S and a molecular weight of 270.76 g/mol. Its IUPAC name is 3-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-4-fluoroaniline.
| Compound Name | 3-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 115280365 |
| Molecular Formula | C12H12ClFN2S |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 3-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-4-fluoroaniline |
| SMILES | CCc1nc(CNc2ccc(F)c(Cl)c2)cs1 |
| InChI | InChI=1S/C12H12ClFN2S/c1-2-12-16-9(7-17-12)6-15-8-3-4-11(14)10(13)5-8/h3-5,7,15H,2,6H2,1H3 |
| InChIKey | KIXZFSDVRKSCDH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |