C12H10F4N2S — CID 107644497
N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-2,3,5,6-tetrafluoroaniline (PubChem CID 107644497) has the molecular formula C12H10F4N2S and a molecular weight of 290.29 g/mol. Its IUPAC name is N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-2,3,5,6-tetrafluoroaniline.
| Compound Name | N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 107644497 |
| Molecular Formula | C12H10F4N2S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-2,3,5,6-tetrafluoroaniline |
| SMILES | CCc1nc(CNc2c(F)c(F)cc(F)c2F)cs1 |
| InChI | InChI=1S/C12H10F4N2S/c1-2-9-18-6(5-19-9)4-17-12-10(15)7(13)3-8(14)11(12)16/h3,5,17H,2,4H2,1H3 |
| InChIKey | XQDVLNQDAQMXFX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|