C15H20N2O3S — CID 60727820
N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-3,4,5-trimethoxyaniline (PubChem CID 60727820) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-3,4,5-trimethoxyaniline.
| Compound Name | N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-3,4,5-trimethoxyaniline |
|---|---|
| PubChem CID | 60727820 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-3,4,5-trimethoxyaniline |
| SMILES | CCc1nc(CNc2cc(OC)c(OC)c(OC)c2)cs1 |
| InChI | InChI=1S/C15H20N2O3S/c1-5-14-17-11(9-21-14)8-16-10-6-12(18-2)15(20-4)13(7-10)19-3/h6-7,9,16H,5,8H2,1-4H3 |
| InChIKey | FMCGLZULUJIIHR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|