C8H8F3N3O2 — CID 115696888
2-(6-oxopyrimidin-1-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 115696888) has the molecular formula C8H8F3N3O2 and a molecular weight of 235.16 g/mol. Its IUPAC name is 2-(6-oxopyrimidin-1-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(6-oxopyrimidin-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 115696888 |
| Molecular Formula | C8H8F3N3O2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-(6-oxopyrimidin-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(Cn1cnccc1=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H8F3N3O2/c9-8(10,11)4-13-6(15)3-14-5-12-2-1-7(14)16/h1-2,5H,3-4H2,(H,13,15) |
| InChIKey | SPCRWGRRAUABEX-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |