C10H14F2N4O — CID 178099242
3-(2,2-difluoroethyl)-5-piperazin-1-ylpyrimidin-4-one (PubChem CID 178099242) has the molecular formula C10H14F2N4O and a molecular weight of 244.24 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-5-piperazin-1-ylpyrimidin-4-one.
| Compound Name | 3-(2,2-difluoroethyl)-5-piperazin-1-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 178099242 |
| Molecular Formula | C10H14F2N4O |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-(2,2-difluoroethyl)-5-piperazin-1-ylpyrimidin-4-one |
| SMILES | O=c1c(N2CCNCC2)cncn1CC(F)F |
| InChI | InChI=1S/C10H14F2N4O/c11-9(12)6-16-7-14-5-8(10(16)17)15-3-1-13-2-4-15/h5,7,9,13H,1-4,6H2 |
| InChIKey | IZUHZMNVZNEPLM-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |