C10H13F3N4O — CID 136957809
4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1H-pyrimidin-6-one (PubChem CID 136957809) has the molecular formula C10H13F3N4O and a molecular weight of 262.23 g/mol. Its IUPAC name is 4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957809 |
| Molecular Formula | C10H13F3N4O |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(N2CCN(CC(F)(F)F)CC2)nc[nH]1 |
| InChI | InChI=1S/C10H13F3N4O/c11-10(12,13)6-16-1-3-17(4-2-16)8-5-9(18)15-7-14-8/h5,7H,1-4,6H2,(H,14,15,18) |
| InChIKey | PHTSAOZUXBNKPV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |