C8H12F2N4O — CID 136728230
4-[2-aminoethyl(2,2-difluoroethyl)amino]-1H-pyrimidin-6-one (PubChem CID 136728230) has the molecular formula C8H12F2N4O and a molecular weight of 218.21 g/mol. Its IUPAC name is 4-[2-aminoethyl(2,2-difluoroethyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 4-[2-aminoethyl(2,2-difluoroethyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136728230 |
| Molecular Formula | C8H12F2N4O |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 4-[2-aminoethyl(2,2-difluoroethyl)amino]-1H-pyrimidin-6-one |
| SMILES | NCCN(CC(F)F)c1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C8H12F2N4O/c9-6(10)4-14(2-1-11)7-3-8(15)13-5-12-7/h3,5-6H,1-2,4,11H2,(H,12,13,15) |
| InChIKey | WUJZJLKVZWBSPN-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |