C8H11F2IN4O — CID 136728231
4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136728231) has the molecular formula C8H11F2IN4O and a molecular weight of 344.10 g/mol. Its IUPAC name is 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136728231 |
| Molecular Formula | C8H11F2IN4O |
| Molecular Weight | 344.10 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | NCCN(CC(F)F)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C8H11F2IN4O/c9-5(10)3-15(2-1-12)7-6(11)8(16)14-4-13-7/h4-5H,1-3,12H2,(H,13,14,16) |
| InChIKey | IAACVNPHEGJUPB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.10 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|