C8H10F3IN4O — CID 136728239
4-[2-aminoethyl(2,2,2-trifluoroethyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136728239) has the molecular formula C8H10F3IN4O and a molecular weight of 362.09 g/mol. Its IUPAC name is 4-[2-aminoethyl(2,2,2-trifluoroethyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-aminoethyl(2,2,2-trifluoroethyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136728239 |
| Molecular Formula | C8H10F3IN4O |
| Molecular Weight | 362.09 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 4-[2-aminoethyl(2,2,2-trifluoroethyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | NCCN(CC(F)(F)F)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C8H10F3IN4O/c9-8(10,11)3-16(2-1-13)6-5(12)7(17)15-4-14-6/h4H,1-3,13H2,(H,14,15,17) |
| InChIKey | RYJSPNKSMLJEOW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.09 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|